C26H32N2O4 — CID 155038960
[4-[3-(4-acetyloxy-2,6-dimethylphenyl)-2-propan-2-yl-2H-imidazol-1-yl]-3,5-dimethylphenyl] acetate (PubChem CID 155038960) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is [4-[3-(4-acetyloxy-2,6-dimethylphenyl)-2-propan-2-yl-2H-imidazol-1-yl]-3,5-dimethylphenyl] acetate.
| Compound Name | [4-[3-(4-acetyloxy-2,6-dimethylphenyl)-2-propan-2-yl-2H-imidazol-1-yl]-3,5-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 155038960 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [4-[3-(4-acetyloxy-2,6-dimethylphenyl)-2-propan-2-yl-2H-imidazol-1-yl]-3,5-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(C)c(N2C=CN(c3c(C)cc(OC(C)=O)cc3C)C2C(C)C)c(C)c1 |
| InChI | InChI=1S/C26H32N2O4/c1-15(2)26-27(24-16(3)11-22(12-17(24)4)31-20(7)29)9-10-28(26)25-18(5)13-23(14-19(25)6)32-21(8)30/h9-15,26H,1-8H3 |
| InChIKey | RHCREEGBNYXGDH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|