C39H40N10O6 — CID 155048017
2-(2,6-dioxopiperidin-3-yl)-4-[[6-[4-[4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]isoindole-1,3-dione (PubChem CID 155048017) has the molecular formula C39H40N10O6 and a molecular weight of 744.81 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[6-[4-[4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[6-[4-[4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155048017 |
| Molecular Formula | C39H40N10O6 |
| Molecular Weight | 744.81 g/mol |
| Exact Mass | 744.31 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[6-[4-[4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCC(=O)N4CCN(c5ccc(-c6ncc(NCc7ccco7)n7cnnc67)cc5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H40N10O6/c50-32-15-14-30(37(52)44-32)49-38(53)28-7-4-8-29(34(28)39(49)54)40-16-3-1-2-9-33(51)47-19-17-46(18-20-47)26-12-10-25(11-13-26)35-36-45-43-24-48(36)31(23-42-35)41-22-27-6-5-21-55-27/h4-8,10-13,21,23-24,30,40-41H,1-3,9,14-20,22H2,(H,44,50,52) |
| InChIKey | MPNJRFNFKXQQHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 187.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|