C44H45N7O7 — CID 172872808
4-[[6-[4-[4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 172872808) has the molecular formula C44H45N7O7 and a molecular weight of 783.89 g/mol. Its IUPAC name is 4-[[6-[4-[4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[6-[4-[4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172872808 |
| Molecular Formula | C44H45N7O7 |
| Molecular Weight | 783.89 g/mol |
| Exact Mass | 783.34 |
| IUPAC Name | 4-[[6-[4-[4-[3-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1ccc(-c2c[nH]c3ncc(-c4ccc(N5CCN(C(=O)CCCCCNc6cccc7c6C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)cc4)cc23)cc1OC |
| InChI | InChI=1S/C44H45N7O7/c1-57-36-16-12-28(24-37(36)58-2)33-26-47-41-32(33)23-29(25-46-41)27-10-13-30(14-11-27)49-19-21-50(22-20-49)39(53)9-4-3-5-18-45-34-8-6-7-31-40(34)44(56)51(43(31)55)35-15-17-38(52)48-42(35)54/h6-8,10-14,16,23-26,35,45H,3-5,9,15,17-22H2,1-2H3,(H,46,47)(H,48,52,54) |
| InChIKey | BJGDGFUAJVQRMP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.89 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|