C44H49N9O6 — CID 164989644
2-(2,6-dioxopiperidin-3-yl)-4-[[10-[4-[4-[5-[2-(furan-2-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]phenyl]piperazin-1-yl]-10-oxodecyl]amino]isoindole-1,3-dione (PubChem CID 164989644) has the molecular formula C44H49N9O6 and a molecular weight of 799.93 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[10-[4-[4-[5-[2-(furan-2-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]phenyl]piperazin-1-yl]-10-oxodecyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[10-[4-[4-[5-[2-(furan-2-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]phenyl]piperazin-1-yl]-10-oxodecyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164989644 |
| Molecular Formula | C44H49N9O6 |
| Molecular Weight | 799.93 g/mol |
| Exact Mass | 799.38 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[10-[4-[4-[5-[2-(furan-2-yl)ethyl]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]phenyl]piperazin-1-yl]-10-oxodecyl]amino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCCCCCC(=O)N4CCN(c5ccc(-c6cnc(CCc7ccco7)n7cnnc67)cc5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H49N9O6/c54-38-21-19-36(42(56)48-38)53-43(57)33-11-8-12-35(40(33)44(53)58)45-22-7-5-3-1-2-4-6-13-39(55)51-25-23-50(24-26-51)31-16-14-30(15-17-31)34-28-46-37(52-29-47-49-41(34)52)20-18-32-10-9-27-59-32/h8-12,14-17,27-29,36,45H,1-7,13,18-26H2,(H,48,54,56) |
| InChIKey | GRCIBCXVLYMUFN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 175.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.93 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|