C43H26FN5S2 — CID 155050477
2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 155050477) has the molecular formula C43H26FN5S2 and a molecular weight of 695.85 g/mol. Its IUPAC name is 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155050477 |
| Molecular Formula | C43H26FN5S2 |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.16 |
| IUPAC Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[(1E,3E)-4-fluorohexa-1,3,5-trienyl]-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | C=C/C(F)=C\C=C\c1nc(-c2cccc3c2sc2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c23)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C43H26FN5S2/c1-2-28(44)18-11-23-33-39-37(29-19-9-10-24-34(29)50-39)46-43(45-33)32-22-12-20-30-36-31(21-13-25-35(36)51-38(30)32)42-48-40(26-14-5-3-6-15-26)47-41(49-42)27-16-7-4-8-17-27/h2-25H,1H2/b23-11+,28-18+ |
| InChIKey | GZWYLDIYYZWLEZ-XNVKBPHKSA-N |
| XLogP | 12.12 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|