C23H25NO4 — CID 155052022
4-[2-(4-methoxyphenyl)-5-(propoxymethyl)-2,3-dihydropyridin-3-yl]benzoic acid (PubChem CID 155052022) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)-5-(propoxymethyl)-2,3-dihydropyridin-3-yl]benzoic acid.
| Compound Name | 4-[2-(4-methoxyphenyl)-5-(propoxymethyl)-2,3-dihydropyridin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 155052022 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)-5-(propoxymethyl)-2,3-dihydropyridin-3-yl]benzoic acid |
| SMILES | CCCOCC1=CC(c2ccc(C(=O)O)cc2)C(c2ccc(OC)cc2)N=C1 |
| InChI | InChI=1S/C23H25NO4/c1-3-12-28-15-16-13-21(17-4-6-19(7-5-17)23(25)26)22(24-14-16)18-8-10-20(27-2)11-9-18/h4-11,13-14,21-22H,3,12,15H2,1-2H3,(H,25,26) |
| InChIKey | HMVQLRFVALRSCP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|