C20H23FN4O2 — CID 155052769
[4-[1-ethyl-2-(fluoroamino)-2,3-dihydrobenzimidazol-4-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 155052769) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is [4-[1-ethyl-2-(fluoroamino)-2,3-dihydrobenzimidazol-4-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[1-ethyl-2-(fluoroamino)-2,3-dihydrobenzimidazol-4-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155052769 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [4-[1-ethyl-2-(fluoroamino)-2,3-dihydrobenzimidazol-4-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | CCN1c2cccc(-c3ccc(C(=O)N4CCOCC4)cc3)c2NC1NF |
| InChI | InChI=1S/C20H23FN4O2/c1-2-25-17-5-3-4-16(18(17)22-20(25)23-21)14-6-8-15(9-7-14)19(26)24-10-12-27-13-11-24/h3-9,20,22-23H,2,10-13H2,1H3 |
| InChIKey | QFEISEBGKVBLHK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|