C42H29N3O4 — CID 155058052
[4-[4,6-bis[4-(4-hydroxynaphthalen-1-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanediol (PubChem CID 155058052) has the molecular formula C42H29N3O4 and a molecular weight of 639.71 g/mol. Its IUPAC name is [4-[4,6-bis[4-(4-hydroxynaphthalen-1-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanediol.
| Compound Name | [4-[4,6-bis[4-(4-hydroxynaphthalen-1-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanediol |
|---|---|
| PubChem CID | 155058052 |
| Molecular Formula | C42H29N3O4 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | [4-[4,6-bis[4-(4-hydroxynaphthalen-1-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanediol |
| SMILES | Oc1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc(O)c6ccccc56)cc4)nc(-c4ccc(C(O)O)cc4)n3)cc2)c2ccccc12 |
| InChI | InChI=1S/C42H29N3O4/c46-37-23-21-31(33-5-1-3-7-35(33)37)25-9-13-27(14-10-25)39-43-40(45-41(44-39)29-17-19-30(20-18-29)42(48)49)28-15-11-26(12-16-28)32-22-24-38(47)36-8-4-2-6-34(32)36/h1-24,42,46-49H |
| InChIKey | PPUZONOYNZAISP-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|