C33H44N2O4 — CID 155061976
methyl (E)-3-[3-[cyclohexanecarbonyl-[5-(4-morpholin-4-ylphenyl)pentyl]amino]phenyl]but-2-enoate (PubChem CID 155061976) has the molecular formula C33H44N2O4 and a molecular weight of 532.73 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[5-(4-morpholin-4-ylphenyl)pentyl]amino]phenyl]but-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[5-(4-morpholin-4-ylphenyl)pentyl]amino]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 155061976 |
| Molecular Formula | C33H44N2O4 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[5-(4-morpholin-4-ylphenyl)pentyl]amino]phenyl]but-2-enoate |
| SMILES | COC(=O)/C=C(\C)c1cccc(N(CCCCCc2ccc(N3CCOCC3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C33H44N2O4/c1-26(24-32(36)38-2)29-13-9-14-31(25-29)35(33(37)28-11-6-3-7-12-28)19-8-4-5-10-27-15-17-30(18-16-27)34-20-22-39-23-21-34/h9,13-18,24-25,28H,3-8,10-12,19-23H2,1-2H3/b26-24+ |
| InChIKey | XDVOWVGOMGIBGJ-SHHOIMCASA-N |
| XLogP | 6.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|