C30H39N3O3 — CID 150285974
methyl (E)-3-[3-[cyclohexanecarbonyl-[[(3R)-1-[4-(dimethylamino)phenyl]pyrrolidin-3-yl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 150285974) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[(3R)-1-[4-(dimethylamino)phenyl]pyrrolidin-3-yl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[(3R)-1-[4-(dimethylamino)phenyl]pyrrolidin-3-yl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 150285974 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[(3R)-1-[4-(dimethylamino)phenyl]pyrrolidin-3-yl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(C[C@@H]2CCN(c3ccc(N(C)C)cc3)C2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C30H39N3O3/c1-31(2)26-13-15-27(16-14-26)32-19-18-24(21-32)22-33(30(35)25-9-5-4-6-10-25)28-11-7-8-23(20-28)12-17-29(34)36-3/h7-8,11-17,20,24-25H,4-6,9-10,18-19,21-22H2,1-3H3/b17-12+/t24-/m1/s1 |
| InChIKey | GGOWBXVEEYBPDT-SKELBMGJSA-N |
| XLogP | 5.38 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|