C31H38N2O4 — CID 126716518
methyl (E)-3-[3-[(1-benzoylpiperidin-4-yl)methyl-(cyclohexanecarbonyl)amino]-5-methylphenyl]prop-2-enoate (PubChem CID 126716518) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is methyl (E)-3-[3-[(1-benzoylpiperidin-4-yl)methyl-(cyclohexanecarbonyl)amino]-5-methylphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(1-benzoylpiperidin-4-yl)methyl-(cyclohexanecarbonyl)amino]-5-methylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 126716518 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | methyl (E)-3-[3-[(1-benzoylpiperidin-4-yl)methyl-(cyclohexanecarbonyl)amino]-5-methylphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(C)cc(N(CC2CCN(C(=O)c3ccccc3)CC2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H38N2O4/c1-23-19-25(13-14-29(34)37-2)21-28(20-23)33(31(36)27-11-7-4-8-12-27)22-24-15-17-32(18-16-24)30(35)26-9-5-3-6-10-26/h3,5-6,9-10,13-14,19-21,24,27H,4,7-8,11-12,15-18,22H2,1-2H3/b14-13+ |
| InChIKey | ZLVLKQCTIOAULS-BUHFOSPRSA-N |
| XLogP | 5.65 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|