C24H25BrFNO4 — CID 123388653
methyl 3-[3-[[(4-bromophenyl)-hydroxymethyl]-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate (PubChem CID 123388653) has the molecular formula C24H25BrFNO4 and a molecular weight of 490.37 g/mol. Its IUPAC name is methyl 3-[3-[[(4-bromophenyl)-hydroxymethyl]-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate.
| Compound Name | methyl 3-[3-[[(4-bromophenyl)-hydroxymethyl]-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123388653 |
| Molecular Formula | C24H25BrFNO4 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | methyl 3-[3-[[(4-bromophenyl)-hydroxymethyl]-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(F)cc(N(C(=O)C2CCCCC2)C(O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C24H25BrFNO4/c1-31-22(28)12-7-16-13-20(26)15-21(14-16)27(23(29)17-5-3-2-4-6-17)24(30)18-8-10-19(25)11-9-18/h7-15,17,24,30H,2-6H2,1H3 |
| InChIKey | WPOZADJWNOIGMH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|