C25H27BrFNO3 — CID 126668257
methyl (E)-3-[3-[1-(4-bromophenyl)ethyl-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate (PubChem CID 126668257) has the molecular formula C25H27BrFNO3 and a molecular weight of 488.40 g/mol. Its IUPAC name is methyl (E)-3-[3-[1-(4-bromophenyl)ethyl-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[1-(4-bromophenyl)ethyl-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 126668257 |
| Molecular Formula | C25H27BrFNO3 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | methyl (E)-3-[3-[1-(4-bromophenyl)ethyl-(cyclohexanecarbonyl)amino]-5-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(F)cc(N(C(=O)C2CCCCC2)C(C)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C25H27BrFNO3/c1-17(19-9-11-21(26)12-10-19)28(25(30)20-6-4-3-5-7-20)23-15-18(14-22(27)16-23)8-13-24(29)31-2/h8-17,20H,3-7H2,1-2H3/b13-8+ |
| InChIKey | DVSDUNVMSIYRGT-MDWZMJQESA-N |
| XLogP | 6.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|