C31H30N2O4S — CID 144922399
methyl (E)-3-[3-[[[4-(1,2-benzothiazol-5-yl)phenyl]-hydroxymethyl]-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate (PubChem CID 144922399) has the molecular formula C31H30N2O4S and a molecular weight of 526.66 g/mol. Its IUPAC name is methyl (E)-3-[3-[[[4-(1,2-benzothiazol-5-yl)phenyl]-hydroxymethyl]-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[[4-(1,2-benzothiazol-5-yl)phenyl]-hydroxymethyl]-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 144922399 |
| Molecular Formula | C31H30N2O4S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | methyl (E)-3-[3-[[[4-(1,2-benzothiazol-5-yl)phenyl]-hydroxymethyl]-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(C(=O)C2CCCCC2)C(O)c2ccc(-c3ccc4sncc4c3)cc2)c1 |
| InChI | InChI=1S/C31H30N2O4S/c1-37-29(34)17-10-21-6-5-9-27(18-21)33(30(35)23-7-3-2-4-8-23)31(36)24-13-11-22(12-14-24)25-15-16-28-26(19-25)20-32-38-28/h5-6,9-20,23,31,36H,2-4,7-8H2,1H3/b17-10+ |
| InChIKey | MGHXMJXRXUVVGN-LICLKQGHSA-N |
| XLogP | 6.75 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|