C32H35FN2O4 — CID 144922304
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-hydroxymethyl]amino]phenyl]prop-2-enoate (PubChem CID 144922304) has the molecular formula C32H35FN2O4 and a molecular weight of 530.64 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-hydroxymethyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-hydroxymethyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 144922304 |
| Molecular Formula | C32H35FN2O4 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]-hydroxymethyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(C(=O)C2CCCCC2)C(O)c2ccc(-c3ccc(N(C)C)cc3)cc2F)c1 |
| InChI | InChI=1S/C32H35FN2O4/c1-34(2)26-16-13-23(14-17-26)25-15-18-28(29(33)21-25)32(38)35(31(37)24-9-5-4-6-10-24)27-11-7-8-22(20-27)12-19-30(36)39-3/h7-8,11-21,24,32,38H,4-6,9-10H2,1-3H3/b19-12+ |
| InChIKey | UJWYEHHBPSASOL-XDHOZWIPSA-N |
| XLogP | 6.35 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|