C32H36ClN3O3 — CID 170057724
methyl (E)-3-[5-[[[2-chloro-4-[4-(dimethylamino)phenyl]phenyl]-hydroxymethyl]-(1-cyclohexylethenyl)amino]-3-pyridinyl]prop-2-enoate (PubChem CID 170057724) has the molecular formula C32H36ClN3O3 and a molecular weight of 546.11 g/mol. Its IUPAC name is methyl (E)-3-[5-[[[2-chloro-4-[4-(dimethylamino)phenyl]phenyl]-hydroxymethyl]-(1-cyclohexylethenyl)amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[[[2-chloro-4-[4-(dimethylamino)phenyl]phenyl]-hydroxymethyl]-(1-cyclohexylethenyl)amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 170057724 |
| Molecular Formula | C32H36ClN3O3 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | methyl (E)-3-[5-[[[2-chloro-4-[4-(dimethylamino)phenyl]phenyl]-hydroxymethyl]-(1-cyclohexylethenyl)amino]-3-pyridinyl]prop-2-enoate |
| SMILES | C=C(C1CCCCC1)N(c1cncc(/C=C/C(=O)OC)c1)C(O)c1ccc(-c2ccc(N(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C32H36ClN3O3/c1-22(24-8-6-5-7-9-24)36(28-18-23(20-34-21-28)10-17-31(37)39-4)32(38)29-16-13-26(19-30(29)33)25-11-14-27(15-12-25)35(2)3/h10-21,24,32,38H,1,5-9H2,2-4H3/b17-10+ |
| InChIKey | SZIJAGKRBCKCNY-LICLKQGHSA-N |
| XLogP | 7.25 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|