C31H29N3O3 — CID 123143457
methyl 3-[5-[benzoyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 123143457) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl 3-[5-[benzoyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-[5-[benzoyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 123143457 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | methyl 3-[5-[benzoyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cncc(N(Cc2ccc(-c3ccc(N(C)C)cc3)cc2)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H29N3O3/c1-33(2)28-16-14-26(15-17-28)25-12-9-23(10-13-25)22-34(31(36)27-7-5-4-6-8-27)29-19-24(20-32-21-29)11-18-30(35)37-3/h4-21H,22H2,1-3H3 |
| InChIKey | RIGHCXVKVKDIGV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|