C27H27FN2O3 — CID 138657691
methyl (E)-3-[3-[acetyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate (PubChem CID 138657691) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is methyl (E)-3-[3-[acetyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[acetyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 138657691 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl (E)-3-[3-[acetyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(F)cc(N(Cc2ccc(-c3ccc(N(C)C)cc3)cc2)C(C)=O)c1 |
| InChI | InChI=1S/C27H27FN2O3/c1-19(31)30(26-16-21(15-24(28)17-26)7-14-27(32)33-4)18-20-5-8-22(9-6-20)23-10-12-25(13-11-23)29(2)3/h5-17H,18H2,1-4H3/b14-7+ |
| InChIKey | QULCQMUKTAUVBI-VGOFMYFVSA-N |
| XLogP | 5.30 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|