C25H26N2O2 — CID 145157219
methyl (E)-3-[3-[methyl-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 145157219) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl (E)-3-[3-[methyl-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[methyl-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 145157219 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | methyl (E)-3-[3-[methyl-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | CNc1ccc(-c2ccc(CN(C)c3cccc(/C=C/C(=O)OC)c3)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O2/c1-26-23-14-12-22(13-15-23)21-10-7-20(8-11-21)18-27(2)24-6-4-5-19(17-24)9-16-25(28)29-3/h4-17,26H,18H2,1-3H3/b16-9+ |
| InChIKey | VKBJZNORJSYYES-CXUHLZMHSA-N |
| XLogP | 5.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|