C28H30N2O3 — CID 11762020
methyl (E)-3-[3-[[4-(3-methylphenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate (PubChem CID 11762020) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is methyl (E)-3-[3-[[4-(3-methylphenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[4-(3-methylphenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11762020 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | methyl (E)-3-[3-[[4-(3-methylphenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(-c3cccc(C)c3)cc2)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C28H30N2O3/c1-20(2)29-28(32)30(26-10-6-8-22(18-26)13-16-27(31)33-4)19-23-11-14-24(15-12-23)25-9-5-7-21(3)17-25/h5-18,20H,19H2,1-4H3,(H,29,32)/b16-13+ |
| InChIKey | PVVKZFHISJARAP-DTQAZKPQSA-N |
| XLogP | 5.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|