C29H30N2O3 — CID 11048716
methyl (E)-3-[3-[[4-[(E)-2-phenylethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate (PubChem CID 11048716) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is methyl (E)-3-[3-[[4-[(E)-2-phenylethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[4-[(E)-2-phenylethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11048716 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | methyl (E)-3-[3-[[4-[(E)-2-phenylethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(/C=C/c3ccccc3)cc2)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C29H30N2O3/c1-22(2)30-29(33)31(27-11-7-10-25(20-27)18-19-28(32)34-3)21-26-16-14-24(15-17-26)13-12-23-8-5-4-6-9-23/h4-20,22H,21H2,1-3H3,(H,30,33)/b13-12+,19-18+ |
| InChIKey | PYKYRRDDPWJGRR-JXNIZTFNSA-N |
| XLogP | 6.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|