C29H28Cl2N2O3 — CID 11049649
methyl (E)-3-[3-[[4-[(E)-2-(2,6-dichlorophenyl)ethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate (PubChem CID 11049649) has the molecular formula C29H28Cl2N2O3 and a molecular weight of 523.46 g/mol. Its IUPAC name is methyl (E)-3-[3-[[4-[(E)-2-(2,6-dichlorophenyl)ethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[4-[(E)-2-(2,6-dichlorophenyl)ethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11049649 |
| Molecular Formula | C29H28Cl2N2O3 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | methyl (E)-3-[3-[[4-[(E)-2-(2,6-dichlorophenyl)ethenyl]phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(/C=C/c3c(Cl)cccc3Cl)cc2)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C29H28Cl2N2O3/c1-20(2)32-29(35)33(24-7-4-6-22(18-24)15-17-28(34)36-3)19-23-12-10-21(11-13-23)14-16-25-26(30)8-5-9-27(25)31/h4-18,20H,19H2,1-3H3,(H,32,35)/b16-14+,17-15+ |
| InChIKey | HVKYZHYUXMRPJM-YXLFCKQPSA-N |
| XLogP | 7.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|