C30H31NO3 — CID 142899243
methyl (E)-3-[3-[2-methylpropanoyl-[2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]amino]phenyl]prop-2-enoate (PubChem CID 142899243) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is methyl (E)-3-[3-[2-methylpropanoyl-[2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[2-methylpropanoyl-[2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142899243 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | methyl (E)-3-[3-[2-methylpropanoyl-[2-[4-[(E)-2-phenylethenyl]phenyl]ethyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(CCc2ccc(/C=C/c3ccccc3)cc2)C(=O)C(C)C)c1 |
| InChI | InChI=1S/C30H31NO3/c1-23(2)30(33)31(28-11-7-10-27(22-28)18-19-29(32)34-3)21-20-26-16-14-25(15-17-26)13-12-24-8-5-4-6-9-24/h4-19,22-23H,20-21H2,1-3H3/b13-12+,19-18+ |
| InChIKey | GPPSIDOUVGEXBO-JXNIZTFNSA-N |
| XLogP | 6.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|