C27H26Cl2N2O3 — CID 11733764
methyl (E)-3-[3-[[4-(3,5-dichlorophenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate (PubChem CID 11733764) has the molecular formula C27H26Cl2N2O3 and a molecular weight of 497.42 g/mol. Its IUPAC name is methyl (E)-3-[3-[[4-(3,5-dichlorophenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[4-(3,5-dichlorophenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11733764 |
| Molecular Formula | C27H26Cl2N2O3 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | methyl (E)-3-[3-[[4-(3,5-dichlorophenyl)phenyl]methyl-(propan-2-ylcarbamoyl)amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(-c3cc(Cl)cc(Cl)c3)cc2)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C27H26Cl2N2O3/c1-18(2)30-27(33)31(25-6-4-5-19(13-25)9-12-26(32)34-3)17-20-7-10-21(11-8-20)22-14-23(28)16-24(29)15-22/h4-16,18H,17H2,1-3H3,(H,30,33)/b12-9+ |
| InChIKey | JXTIDQVKNQXJPM-FMIVXFBMSA-N |
| XLogP | 6.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|