C32H34N2O3 — CID 145157215
methyl (E)-3-[3-[(1-cyclohexyl-2-oxoethenyl)-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 145157215) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is methyl (E)-3-[3-[(1-cyclohexyl-2-oxoethenyl)-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(1-cyclohexyl-2-oxoethenyl)-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 145157215 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | methyl (E)-3-[3-[(1-cyclohexyl-2-oxoethenyl)-[[4-[4-(methylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | CNc1ccc(-c2ccc(CN(C(=C=O)C3CCCCC3)c3cccc(/C=C/C(=O)OC)c3)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-33-29-18-16-27(17-19-29)26-14-11-25(12-15-26)22-34(31(23-35)28-8-4-3-5-9-28)30-10-6-7-24(21-30)13-20-32(36)37-2/h6-7,10-21,28,33H,3-5,8-9,22H2,1-2H3/b20-13+ |
| InChIKey | OYLWSRJIKKHCDH-DEDYPNTBSA-N |
| XLogP | 6.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|