C31H26F2N2O3 — CID 135310349
(E)-3-[3-[(3,4-difluorobenzoyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 135310349) has the molecular formula C31H26F2N2O3 and a molecular weight of 512.56 g/mol. Its IUPAC name is (E)-3-[3-[(3,4-difluorobenzoyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(3,4-difluorobenzoyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135310349 |
| Molecular Formula | C31H26F2N2O3 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (E)-3-[3-[(3,4-difluorobenzoyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc(-c2ccc(CN(C(=O)c3ccc(F)c(F)c3)c3cccc(/C=C/C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C31H26F2N2O3/c1-34(2)26-14-11-24(12-15-26)23-9-6-22(7-10-23)20-35(31(38)25-13-16-28(32)29(33)19-25)27-5-3-4-21(18-27)8-17-30(36)37/h3-19H,20H2,1-2H3,(H,36,37)/b17-8+ |
| InChIKey | XCUOHSCBGRXGFV-CAOOACKPSA-N |
| XLogP | 6.64 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|