C32H30N2O4 — CID 135310440
(E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-(4-methoxybenzoyl)amino]phenyl]prop-2-enoic acid (PubChem CID 135310440) has the molecular formula C32H30N2O4 and a molecular weight of 506.60 g/mol. Its IUPAC name is (E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-(4-methoxybenzoyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-(4-methoxybenzoyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135310440 |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-(4-methoxybenzoyl)amino]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C(=O)N(Cc2ccc(-c3ccc(N(C)C)cc3)cc2)c2cccc(/C=C/C(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H30N2O4/c1-33(2)28-16-12-26(13-17-28)25-10-7-24(8-11-25)22-34(32(37)27-14-18-30(38-3)19-15-27)29-6-4-5-23(21-29)9-20-31(35)36/h4-21H,22H2,1-3H3,(H,35,36)/b20-9+ |
| InChIKey | RVAXIBQOFZILPP-AWQFTUOYSA-N |
| XLogP | 6.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|