C32H34N2O4 — CID 145278110
(E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-[4-(hydroxymethylidene)cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 145278110) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is (E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-[4-(hydroxymethylidene)cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-[4-(hydroxymethylidene)cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 145278110 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (E)-3-[3-[[4-[4-(dimethylamino)phenyl]phenyl]methyl-[4-(hydroxymethylidene)cyclohexanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc(-c2ccc(CN(C(=O)C3CCC(=CO)CC3)c3cccc(/C=C/C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O4/c1-33(2)29-17-15-27(16-18-29)26-11-6-24(7-12-26)21-34(32(38)28-13-8-25(22-35)9-14-28)30-5-3-4-23(20-30)10-19-31(36)37/h3-7,10-12,15-20,22,28,35H,8-9,13-14,21H2,1-2H3,(H,36,37)/b19-10+,25-22- |
| InChIKey | SWZUECQVJGOFIX-OQEZQMKESA-N |
| XLogP | 6.68 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|