C31H33N3O3 — CID 118367947
(E)-3-[3-[cyclohexanecarbonyl-[[4-(1,2,3,4-tetrahydroquinoxalin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 118367947) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is (E)-3-[3-[cyclohexanecarbonyl-[[4-(1,2,3,4-tetrahydroquinoxalin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[cyclohexanecarbonyl-[[4-(1,2,3,4-tetrahydroquinoxalin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367947 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (E)-3-[3-[cyclohexanecarbonyl-[[4-(1,2,3,4-tetrahydroquinoxalin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(N(Cc2ccc(-c3ccc4c(c3)NCCN4)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H33N3O3/c35-30(36)16-11-22-5-4-8-27(19-22)34(31(37)25-6-2-1-3-7-25)21-23-9-12-24(13-10-23)26-14-15-28-29(20-26)33-18-17-32-28/h4-5,8-16,19-20,25,32-33H,1-3,6-7,17-18,21H2,(H,35,36)/b16-11+ |
| InChIKey | UIUKTAYVDPKFLG-LFIBNONCSA-N |
| XLogP | 6.40 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|