C30H28N2O4 — CID 163876107
3-[3-[[4-(1,2-benzoxazol-5-yl)phenyl]methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoic acid (PubChem CID 163876107) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3-[3-[[4-(1,2-benzoxazol-5-yl)phenyl]methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[4-(1,2-benzoxazol-5-yl)phenyl]methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163876107 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[3-[[4-(1,2-benzoxazol-5-yl)phenyl]methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(N(Cc2ccc(-c3ccc4oncc4c3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C30H28N2O4/c33-29(34)16-11-21-5-4-8-27(17-21)32(30(35)24-6-2-1-3-7-24)20-22-9-12-23(13-10-22)25-14-15-28-26(18-25)19-31-36-28/h4-5,8-19,24H,1-3,6-7,20H2,(H,33,34) |
| InChIKey | POZVPHMDXDSZJN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|