C31H30N2O3S — CID 118367665
(E)-3-[3-[cyclohexanecarbonyl-[[4-(2-methyl-1,3-benzothiazol-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 118367665) has the molecular formula C31H30N2O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is (E)-3-[3-[cyclohexanecarbonyl-[[4-(2-methyl-1,3-benzothiazol-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[cyclohexanecarbonyl-[[4-(2-methyl-1,3-benzothiazol-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367665 |
| Molecular Formula | C31H30N2O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | (E)-3-[3-[cyclohexanecarbonyl-[[4-(2-methyl-1,3-benzothiazol-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1nc2ccc(-c3ccc(CN(C(=O)C4CCCCC4)c4cccc(/C=C/C(=O)O)c4)cc3)cc2s1 |
| InChI | InChI=1S/C31H30N2O3S/c1-21-32-28-16-15-26(19-29(28)37-21)24-13-10-23(11-14-24)20-33(31(36)25-7-3-2-4-8-25)27-9-5-6-22(18-27)12-17-30(34)35/h5-6,9-19,25H,2-4,7-8,20H2,1H3,(H,34,35)/b17-12+ |
| InChIKey | MYMQXSHZMOCIBJ-SFQUDFHCSA-N |
| XLogP | 7.48 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|