C31H31NO5 — CID 118367846
(E)-3-[3-[cyclohexanecarbonyl-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 118367846) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is (E)-3-[3-[cyclohexanecarbonyl-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[cyclohexanecarbonyl-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367846 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (E)-3-[3-[cyclohexanecarbonyl-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(N(Cc2ccc(-c3ccc4c(c3)OCCO4)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H31NO5/c33-30(34)16-11-22-5-4-8-27(19-22)32(31(35)25-6-2-1-3-7-25)21-23-9-12-24(13-10-23)26-14-15-28-29(20-26)37-18-17-36-28/h4-5,8-16,19-20,25H,1-3,6-7,17-18,21H2,(H,33,34)/b16-11+ |
| InChIKey | ZRWJCRSKBYHTEY-LFIBNONCSA-N |
| XLogP | 6.34 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|