C31H25ClN4O3 — CID 118370854
methyl (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 118370854) has the molecular formula C31H25ClN4O3 and a molecular weight of 537.02 g/mol. Its IUPAC name is methyl (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 118370854 |
| Molecular Formula | C31H25ClN4O3 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | methyl (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cncc(N(Cc2ccc(-c3ccc4c(cnn4C)c3)cc2Cl)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H25ClN4O3/c1-35-29-12-11-23(15-26(29)18-34-35)24-9-10-25(28(32)16-24)20-36(31(38)22-6-4-3-5-7-22)27-14-21(17-33-19-27)8-13-30(37)39-2/h3-19H,20H2,1-2H3/b13-8+ |
| InChIKey | YDYFAZJUZGPVTF-MDWZMJQESA-N |
| XLogP | 6.32 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|