C33H33FN4O3 — CID 145306994
benzaldehyde;(E)-3-[5-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]-3-pyridinyl]prop-2-enal;methoxymethane (PubChem CID 145306994) has the molecular formula C33H33FN4O3 and a molecular weight of 552.65 g/mol. Its IUPAC name is benzaldehyde;(E)-3-[5-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]-3-pyridinyl]prop-2-enal;methoxymethane.
| Compound Name | benzaldehyde;(E)-3-[5-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]-3-pyridinyl]prop-2-enal;methoxymethane |
|---|---|
| PubChem CID | 145306994 |
| Molecular Formula | C33H33FN4O3 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | benzaldehyde;(E)-3-[5-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]-3-pyridinyl]prop-2-enal;methoxymethane |
| SMILES | CN(Cc1ccc(-c2ccc3c(cnn3C)c2)cc1F)c1cncc(/C=C/C=O)c1.COC.O=Cc1ccccc1 |
| InChI | InChI=1S/C24H21FN4O.C7H6O.C2H6O/c1-28(22-10-17(4-3-9-30)13-26-15-22)16-20-6-5-19(12-23(20)25)18-7-8-24-21(11-18)14-27-29(24)2;8-6-7-4-2-1-3-5-7;1-3-2/h3-15H,16H2,1-2H3;1-6H;1-2H3/b4-3+;; |
| InChIKey | DCNWKZIUWLYEKR-CZEFNJPISA-N |
| XLogP | 6.38 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|