C29H23ClN4O2 — CID 118367759
(E)-3-[5-(N-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]-deuteriomethyl]anilino)-3-pyridinyl]prop-2-enoic acid (PubChem CID 118367759) has the molecular formula C29H23ClN4O2 and a molecular weight of 495.99 g/mol. Its IUPAC name is (E)-3-[5-(N-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]-deuteriomethyl]anilino)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(N-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]-deuteriomethyl]anilino)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367759 |
| Molecular Formula | C29H23ClN4O2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (E)-3-[5-(N-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]-deuteriomethyl]anilino)-3-pyridinyl]prop-2-enoic acid |
| SMILES | [2H]C(c1ccc(-c2ccc3c(cnn3C)c2)cc1Cl)N(c1ccccc1)c1cncc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C29H23ClN4O2/c1-33-28-11-10-21(14-24(28)17-32-33)22-8-9-23(27(30)15-22)19-34(25-5-3-2-4-6-25)26-13-20(16-31-18-26)7-12-29(35)36/h2-18H,19H2,1H3,(H,35,36)/b12-7+/i19D |
| InChIKey | IYDORCYKZGEMBJ-LZZXYOGYSA-N |
| XLogP | 6.72 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|