C30H26F2N2O2 — CID 129105045
(E)-3-[3-(N-[deuterio-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]methyl]anilino)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 129105045) has the molecular formula C30H26F2N2O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is (E)-3-[3-(N-[deuterio-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]methyl]anilino)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(N-[deuterio-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]methyl]anilino)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 129105045 |
| Molecular Formula | C30H26F2N2O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (E)-3-[3-(N-[deuterio-[4-[4-(dimethylamino)phenyl]-2-fluorophenyl]methyl]anilino)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | [2H]C(c1ccc(-c2ccc(N(C)C)cc2)cc1F)N(c1ccccc1)c1cc(F)cc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C30H26F2N2O2/c1-33(2)26-13-11-22(12-14-26)23-9-10-24(29(32)18-23)20-34(27-6-4-3-5-7-27)28-17-21(8-15-30(35)36)16-25(31)19-28/h3-19H,20H2,1-2H3,(H,35,36)/b15-8+/i20D |
| InChIKey | DEVWBEWRMSMQNI-CNGCJGAMSA-N |
| XLogP | 7.13 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|