C30H23ClN4O3 — CID 118367807
(E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 118367807) has the molecular formula C30H23ClN4O3 and a molecular weight of 522.99 g/mol. Its IUPAC name is (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367807 |
| Molecular Formula | C30H23ClN4O3 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (E)-3-[5-[benzoyl-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cn1ncc2cc(-c3ccc(CN(C(=O)c4ccccc4)c4cncc(/C=C/C(=O)O)c4)c(Cl)c3)ccc21 |
| InChI | InChI=1S/C30H23ClN4O3/c1-34-28-11-10-22(14-25(28)17-33-34)23-8-9-24(27(31)15-23)19-35(30(38)21-5-3-2-4-6-21)26-13-20(16-32-18-26)7-12-29(36)37/h2-18H,19H2,1H3,(H,36,37)/b12-7+ |
| InChIKey | APHAYOVNWQHFCW-KPKJPENVSA-N |
| XLogP | 6.23 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|