C34H34ClN3O3 — CID 145306921
benzaldehyde;(E)-3-[3-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]phenyl]prop-2-enal;methoxymethane (PubChem CID 145306921) has the molecular formula C34H34ClN3O3 and a molecular weight of 568.12 g/mol. Its IUPAC name is benzaldehyde;(E)-3-[3-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]phenyl]prop-2-enal;methoxymethane.
| Compound Name | benzaldehyde;(E)-3-[3-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]phenyl]prop-2-enal;methoxymethane |
|---|---|
| PubChem CID | 145306921 |
| Molecular Formula | C34H34ClN3O3 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | benzaldehyde;(E)-3-[3-[[2-chloro-4-(1-methylindazol-5-yl)phenyl]methyl-methylamino]phenyl]prop-2-enal;methoxymethane |
| SMILES | CN(Cc1ccc(-c2ccc3c(cnn3C)c2)cc1Cl)c1cccc(/C=C/C=O)c1.COC.O=Cc1ccccc1 |
| InChI | InChI=1S/C25H22ClN3O.C7H6O.C2H6O/c1-28(23-7-3-5-18(13-23)6-4-12-30)17-21-9-8-20(15-24(21)26)19-10-11-25-22(14-19)16-27-29(25)2;8-6-7-4-2-1-3-5-7;1-3-2/h3-16H,17H2,1-2H3;1-6H;1-2H3/b6-4+;; |
| InChIKey | JKMILVQVKPCTBW-SLNOCBGISA-N |
| XLogP | 7.50 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|