C32H26FN3O3 — CID 123554430
methyl 3-[3-[benzoyl-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 123554430) has the molecular formula C32H26FN3O3 and a molecular weight of 519.58 g/mol. Its IUPAC name is methyl 3-[3-[benzoyl-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[3-[benzoyl-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123554430 |
| Molecular Formula | C32H26FN3O3 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | methyl 3-[3-[benzoyl-[[2-fluoro-4-(1-methylindazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cccc(N(Cc2ccc(-c3ccc4c(cnn4C)c3)cc2F)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C32H26FN3O3/c1-35-30-15-14-24(18-27(30)20-34-35)25-12-13-26(29(33)19-25)21-36(32(38)23-8-4-3-5-9-23)28-10-6-7-22(17-28)11-16-31(37)39-2/h3-20H,21H2,1-2H3 |
| InChIKey | QWMSCOYJUGHSTM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|