C31H24FN3O3 — CID 118367934
(E)-3-[3-[benzoyl-[[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoic acid (PubChem CID 118367934) has the molecular formula C31H24FN3O3 and a molecular weight of 505.55 g/mol. Its IUPAC name is (E)-3-[3-[benzoyl-[[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[benzoyl-[[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367934 |
| Molecular Formula | C31H24FN3O3 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (E)-3-[3-[benzoyl-[[4-(1-methylindazol-5-yl)phenyl]methyl]amino]-5-fluorophenyl]prop-2-enoic acid |
| SMILES | Cn1ncc2cc(-c3ccc(CN(C(=O)c4ccccc4)c4cc(F)cc(/C=C/C(=O)O)c4)cc3)ccc21 |
| InChI | InChI=1S/C31H24FN3O3/c1-34-29-13-12-25(17-26(29)19-33-34)23-10-7-21(8-11-23)20-35(31(38)24-5-3-2-4-6-24)28-16-22(9-14-30(36)37)15-27(32)18-28/h2-19H,20H2,1H3,(H,36,37)/b14-9+ |
| InChIKey | PXBYSCSPIXONOQ-NTEUORMPSA-N |
| XLogP | 6.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|