C33H30ClFN2O3 — CID 145157030
methyl (E)-3-[3-[[2-chloro-4-[4-(methylamino)phenyl]phenyl]methyl-methylamino]-5-fluorophenyl]prop-2-enoate;2-phenylethenone (PubChem CID 145157030) has the molecular formula C33H30ClFN2O3 and a molecular weight of 557.07 g/mol. Its IUPAC name is methyl (E)-3-[3-[[2-chloro-4-[4-(methylamino)phenyl]phenyl]methyl-methylamino]-5-fluorophenyl]prop-2-enoate;2-phenylethenone.
| Compound Name | methyl (E)-3-[3-[[2-chloro-4-[4-(methylamino)phenyl]phenyl]methyl-methylamino]-5-fluorophenyl]prop-2-enoate;2-phenylethenone |
|---|---|
| PubChem CID | 145157030 |
| Molecular Formula | C33H30ClFN2O3 |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | methyl (E)-3-[3-[[2-chloro-4-[4-(methylamino)phenyl]phenyl]methyl-methylamino]-5-fluorophenyl]prop-2-enoate;2-phenylethenone |
| SMILES | CNc1ccc(-c2ccc(CN(C)c3cc(F)cc(/C=C/C(=O)OC)c3)c(Cl)c2)cc1.O=C=Cc1ccccc1 |
| InChI | InChI=1S/C25H24ClFN2O2.C8H6O/c1-28-22-9-7-18(8-10-22)19-5-6-20(24(26)14-19)16-29(2)23-13-17(12-21(27)15-23)4-11-25(30)31-3;9-7-6-8-4-2-1-3-5-8/h4-15,28H,16H2,1-3H3;1-6H/b11-4+; |
| InChIKey | QRCCMKGGIOIXGE-SODSUQDMSA-N |
| XLogP | 7.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|