C25H39NO5 — CID 155066893
[(3R,5S,7S,8S,9S,10S,13R,14S,17S)-17-(4-amino-4-oxobutyl)-7-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 155066893) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is [(3R,5S,7S,8S,9S,10S,13R,14S,17S)-17-(4-amino-4-oxobutyl)-7-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3R,5S,7S,8S,9S,10S,13R,14S,17S)-17-(4-amino-4-oxobutyl)-7-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 155066893 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [(3R,5S,7S,8S,9S,10S,13R,14S,17S)-17-(4-amino-4-oxobutyl)-7-formyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | C[C@]12CC[C@@H](OC=O)C[C@H]1C[C@H](OC=O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](CCCC(N)=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H39NO5/c1-24-11-9-20-23(19(24)7-6-16(24)4-3-5-22(26)29)21(31-15-28)13-17-12-18(30-14-27)8-10-25(17,20)2/h14-21,23H,3-13H2,1-2H3,(H2,26,29)/t16-,17-,18+,19-,20-,21-,23-,24+,25-/m0/s1 |
| InChIKey | NRKCQSUJKPOADQ-UXBIHXFWSA-N |
| XLogP | 3.99 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|