C27H35ClF2N4O2 — CID 155069788
1-[4-[[1-[6-chloro-5-[dimethylamino(hydroxy)methyl]-2-pyridinyl]piperidin-4-yl]methyl]piperidin-1-yl]-2,2-difluoro-2-phenylethanone (PubChem CID 155069788) has the molecular formula C27H35ClF2N4O2 and a molecular weight of 521.05 g/mol. Its IUPAC name is 1-[4-[[1-[6-chloro-5-[dimethylamino(hydroxy)methyl]-2-pyridinyl]piperidin-4-yl]methyl]piperidin-1-yl]-2,2-difluoro-2-phenylethanone.
| Compound Name | 1-[4-[[1-[6-chloro-5-[dimethylamino(hydroxy)methyl]-2-pyridinyl]piperidin-4-yl]methyl]piperidin-1-yl]-2,2-difluoro-2-phenylethanone |
|---|---|
| PubChem CID | 155069788 |
| Molecular Formula | C27H35ClF2N4O2 |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 1-[4-[[1-[6-chloro-5-[dimethylamino(hydroxy)methyl]-2-pyridinyl]piperidin-4-yl]methyl]piperidin-1-yl]-2,2-difluoro-2-phenylethanone |
| SMILES | CN(C)C(O)c1ccc(N2CCC(CC3CCN(C(=O)C(F)(F)c4ccccc4)CC3)CC2)nc1Cl |
| InChI | InChI=1S/C27H35ClF2N4O2/c1-32(2)25(35)22-8-9-23(31-24(22)28)33-14-10-19(11-15-33)18-20-12-16-34(17-13-20)26(36)27(29,30)21-6-4-3-5-7-21/h3-9,19-20,25,35H,10-18H2,1-2H3 |
| InChIKey | XURBVDPOXXSTCN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|