C23H31ClF3N3O3 — CID 155263328
2-chloro-6-[4-[[1-[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde (PubChem CID 155263328) has the molecular formula C23H31ClF3N3O3 and a molecular weight of 489.97 g/mol. Its IUPAC name is 2-chloro-6-[4-[[1-[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde.
| Compound Name | 2-chloro-6-[4-[[1-[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 155263328 |
| Molecular Formula | C23H31ClF3N3O3 |
| Molecular Weight | 489.97 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-chloro-6-[4-[[1-[2-hydroxy-3-methyl-2-(trifluoromethyl)butanoyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde |
| SMILES | CC(C)C(O)(C(=O)N1CCC(CC2CCN(c3ccc(C=O)c(Cl)n3)CC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C23H31ClF3N3O3/c1-15(2)22(33,23(25,26)27)21(32)30-11-7-17(8-12-30)13-16-5-9-29(10-6-16)19-4-3-18(14-31)20(24)28-19/h3-4,14-17,33H,5-13H2,1-2H3 |
| InChIKey | PLAYMJSPHBMHQN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|