C27H34ClN3O3 — CID 155263099
2-chloro-6-[4-[[1-[2-(3-ethylphenyl)-2-hydroxyacetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde (PubChem CID 155263099) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is 2-chloro-6-[4-[[1-[2-(3-ethylphenyl)-2-hydroxyacetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde.
| Compound Name | 2-chloro-6-[4-[[1-[2-(3-ethylphenyl)-2-hydroxyacetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 155263099 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-chloro-6-[4-[[1-[2-(3-ethylphenyl)-2-hydroxyacetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde |
| SMILES | CCc1cccc(C(O)C(=O)N2CCC(CC3CCN(c4ccc(C=O)c(Cl)n4)CC3)CC2)c1 |
| InChI | InChI=1S/C27H34ClN3O3/c1-2-19-4-3-5-22(17-19)25(33)27(34)31-14-10-21(11-15-31)16-20-8-12-30(13-9-20)24-7-6-23(18-32)26(28)29-24/h3-7,17-18,20-21,25,33H,2,8-16H2,1H3 |
| InChIKey | MNODQLTVXAKPMP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|