C26H32ClN3O4 — CID 155263060
2-chloro-6-[4-[[1-[2-hydroxy-2-(3-methoxyphenyl)acetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde (PubChem CID 155263060) has the molecular formula C26H32ClN3O4 and a molecular weight of 486.01 g/mol. Its IUPAC name is 2-chloro-6-[4-[[1-[2-hydroxy-2-(3-methoxyphenyl)acetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde.
| Compound Name | 2-chloro-6-[4-[[1-[2-hydroxy-2-(3-methoxyphenyl)acetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 155263060 |
| Molecular Formula | C26H32ClN3O4 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-chloro-6-[4-[[1-[2-hydroxy-2-(3-methoxyphenyl)acetyl]piperidin-4-yl]methyl]piperidin-1-yl]pyridine-3-carbaldehyde |
| SMILES | COc1cccc(C(O)C(=O)N2CCC(CC3CCN(c4ccc(C=O)c(Cl)n4)CC3)CC2)c1 |
| InChI | InChI=1S/C26H32ClN3O4/c1-34-22-4-2-3-20(16-22)24(32)26(33)30-13-9-19(10-14-30)15-18-7-11-29(12-8-18)23-6-5-21(17-31)25(27)28-23/h2-6,16-19,24,32H,7-15H2,1H3 |
| InChIKey | GPZGNQFXPKVAIN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|