C29H38ClN3O4 — CID 155069797
1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-1-yl]-2-(3-methoxyphenyl)ethane-1,2-dione (PubChem CID 155069797) has the molecular formula C29H38ClN3O4 and a molecular weight of 528.09 g/mol. Its IUPAC name is 1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-1-yl]-2-(3-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-1-yl]-2-(3-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 155069797 |
| Molecular Formula | C29H38ClN3O4 |
| Molecular Weight | 528.09 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]piperidin-1-yl]-2-(3-methoxyphenyl)ethane-1,2-dione |
| SMILES | COc1cccc(C(=O)C(=O)N2CCC(CC3CCN(c4ccc(C(O)N(C)C)c(Cl)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C29H38ClN3O4/c1-31(2)28(35)25-8-7-23(19-26(25)30)32-13-9-20(10-14-32)17-21-11-15-33(16-12-21)29(36)27(34)22-5-4-6-24(18-22)37-3/h4-8,18-21,28,35H,9-17H2,1-3H3 |
| InChIKey | IGJRTKULAZFMMR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.09 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|