C30H41ClF3N3O3 — CID 155263024
1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]azepan-1-yl]-3,3,3-trifluoro-2-phenylpropane-1,2-diol (PubChem CID 155263024) has the molecular formula C30H41ClF3N3O3 and a molecular weight of 584.12 g/mol. Its IUPAC name is 1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]azepan-1-yl]-3,3,3-trifluoro-2-phenylpropane-1,2-diol.
| Compound Name | 1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]azepan-1-yl]-3,3,3-trifluoro-2-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 155263024 |
| Molecular Formula | C30H41ClF3N3O3 |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 1-[4-[[1-[3-chloro-4-[dimethylamino(hydroxy)methyl]phenyl]piperidin-4-yl]methyl]azepan-1-yl]-3,3,3-trifluoro-2-phenylpropane-1,2-diol |
| SMILES | CN(C)C(O)c1ccc(N2CCC(CC3CCCN(C(O)C(O)(c4ccccc4)C(F)(F)F)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C30H41ClF3N3O3/c1-35(2)27(38)25-11-10-24(20-26(25)31)36-16-12-22(13-17-36)19-21-7-6-15-37(18-14-21)28(39)29(40,30(32,33)34)23-8-4-3-5-9-23/h3-5,8-11,20-22,27-28,38-40H,6-7,12-19H2,1-2H3 |
| InChIKey | NHHMDIZONOZYIO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|