C25H26ClF3N8O4 — CID 155071341
tert-butyl 2-[[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]amino]acetate (PubChem CID 155071341) has the molecular formula C25H26ClF3N8O4 and a molecular weight of 594.98 g/mol. Its IUPAC name is tert-butyl 2-[[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]amino]acetate.
| Compound Name | tert-butyl 2-[[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]amino]acetate |
|---|---|
| PubChem CID | 155071341 |
| Molecular Formula | C25H26ClF3N8O4 |
| Molecular Weight | 594.98 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | tert-butyl 2-[[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNc1ccncc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C25H26ClF3N8O4/c1-24(2,3)41-21(39)11-31-17-8-9-30-10-18(17)37-14-32-20(33-37)13-36-23(40)35(12-19(38)25(27,28)29)22(34-36)15-4-6-16(26)7-5-15/h4-10,14,19,38H,11-13H2,1-3H3,(H,30,31) |
| InChIKey | ODHMLTDVPUWUOO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.98 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |