C26H27ClF3N7O4 — CID 159974179
tert-butyl 3-[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]propanoate (PubChem CID 159974179) has the molecular formula C26H27ClF3N7O4 and a molecular weight of 593.99 g/mol. Its IUPAC name is tert-butyl 3-[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]propanoate.
| Compound Name | tert-butyl 3-[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]propanoate |
|---|---|
| PubChem CID | 159974179 |
| Molecular Formula | C26H27ClF3N7O4 |
| Molecular Weight | 593.99 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | tert-butyl 3-[3-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-4-pyridinyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1ccncc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C26H27ClF3N7O4/c1-25(2,3)41-22(39)9-6-16-10-11-31-12-19(16)37-15-32-21(33-37)14-36-24(40)35(13-20(38)26(28,29)30)23(34-36)17-4-7-18(27)8-5-17/h4-5,7-8,10-12,15,20,38H,6,9,13-14H2,1-3H3/t20-/m0/s1 |
| InChIKey | OEXZRSCNYMLGIC-FQEVSTJZSA-N |
| XLogP | 3.59 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.99 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |